C21H32ClN3O4S — CID 93146211
(2R)-2-[(2S)-butan-2-yl]-8-(3-chlorophenyl)sulfonyl-4-(3-methoxypropyl)-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 93146211) has the molecular formula C21H32ClN3O4S and a molecular weight of 458.02 g/mol. Its IUPAC name is (2R)-2-[(2S)-butan-2-yl]-8-(3-chlorophenyl)sulfonyl-4-(3-methoxypropyl)-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | (2R)-2-[(2S)-butan-2-yl]-8-(3-chlorophenyl)sulfonyl-4-(3-methoxypropyl)-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 93146211 |
| Molecular Formula | C21H32ClN3O4S |
| Molecular Weight | 458.02 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (2R)-2-[(2S)-butan-2-yl]-8-(3-chlorophenyl)sulfonyl-4-(3-methoxypropyl)-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | CC[C@H](C)[C@H]1NC2(CCN(S(=O)(=O)c3cccc(Cl)c3)CC2)N(CCCOC)C1=O |
| InChI | InChI=1S/C21H32ClN3O4S/c1-4-16(2)19-20(26)25(11-6-14-29-3)21(23-19)9-12-24(13-10-21)30(27,28)18-8-5-7-17(22)15-18/h5,7-8,15-16,19,23H,4,6,9-14H2,1-3H3/t16-,19+/m0/s1 |
| InChIKey | JKNGSECSRMVHOO-QFBILLFUSA-N |
| XLogP | 2.70 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.02 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|