C13H18N2O2S — CID 115301718
(3R)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidin-3-amine (PubChem CID 115301718) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is (3R)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidin-3-amine.
| Compound Name | (3R)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 115301718 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3R)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidin-3-amine |
| SMILES | N[C@@H]1CCN(S(=O)(=O)c2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C13H18N2O2S/c14-12-6-7-15(9-12)18(16,17)13-5-4-10-2-1-3-11(10)8-13/h4-5,8,12H,1-3,6-7,9,14H2/t12-/m1/s1 |
| InChIKey | CZKFRAPADLDVPK-GFCCVEGCSA-N |
| XLogP | 0.90 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |