C15H20ClNO2S — CID 114801907
3-(2-chloroethyl)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidine (PubChem CID 114801907) has the molecular formula C15H20ClNO2S and a molecular weight of 313.85 g/mol. Its IUPAC name is 3-(2-chloroethyl)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidine.
| Compound Name | 3-(2-chloroethyl)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidine |
|---|---|
| PubChem CID | 114801907 |
| Molecular Formula | C15H20ClNO2S |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-(2-chloroethyl)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidine |
| SMILES | O=S(=O)(c1ccc2c(c1)CCC2)N1CCC(CCCl)C1 |
| InChI | InChI=1S/C15H20ClNO2S/c16-8-6-12-7-9-17(11-12)20(18,19)15-5-4-13-2-1-3-14(13)10-15/h4-5,10,12H,1-3,6-9,11H2 |
| InChIKey | VWIRIMFYGPMYJN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|