C10H9NO2S — CID 10512518
N-(oxomethylidene)-2,3-dihydro-1H-indene-5-sulfinamide (PubChem CID 10512518) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is N-(oxomethylidene)-2,3-dihydro-1H-indene-5-sulfinamide.
| Compound Name | N-(oxomethylidene)-2,3-dihydro-1H-indene-5-sulfinamide |
|---|---|
| PubChem CID | 10512518 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | N-(oxomethylidene)-2,3-dihydro-1H-indene-5-sulfinamide |
| SMILES | O=C=NS(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H9NO2S/c12-7-11-14(13)10-5-4-8-2-1-3-9(8)6-10/h4-6H,1-3H2 |
| InChIKey | BPRRKSWEYDZLJC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|