C18H18O2S — CID 116694915
3-(2,3-dihydro-1H-inden-5-ylsulfinyl)-1-phenylpropan-1-one (PubChem CID 116694915) has the molecular formula C18H18O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylsulfinyl)-1-phenylpropan-1-one.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylsulfinyl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 116694915 |
| Molecular Formula | C18H18O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylsulfinyl)-1-phenylpropan-1-one |
| SMILES | O=C(CCS(=O)c1ccc2c(c1)CCC2)c1ccccc1 |
| InChI | InChI=1S/C18H18O2S/c19-18(15-5-2-1-3-6-15)11-12-21(20)17-10-9-14-7-4-8-16(14)13-17/h1-3,5-6,9-10,13H,4,7-8,11-12H2 |
| InChIKey | FJAIGZOEGZRULD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |