C8H9NO3S — CID 165402240
7-amino-2,3-dihydro-1-benzofuran-5-sulfinic acid (PubChem CID 165402240) has the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. Its IUPAC name is 7-amino-2,3-dihydro-1-benzofuran-5-sulfinic acid.
| Compound Name | 7-amino-2,3-dihydro-1-benzofuran-5-sulfinic acid |
|---|---|
| PubChem CID | 165402240 |
| Molecular Formula | C8H9NO3S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | 7-amino-2,3-dihydro-1-benzofuran-5-sulfinic acid |
| SMILES | Nc1cc(S(=O)O)cc2c1OCC2 |
| InChI | InChI=1S/C8H9NO3S/c9-7-4-6(13(10)11)3-5-1-2-12-8(5)7/h3-4H,1-2,9H2,(H,10,11) |
| InChIKey | HQROBHBUBVXTOI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|