C17H16ClNO2 — CID 102707076
(5-amino-2,4-dimethylphenyl)-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methanone (PubChem CID 102707076) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is (5-amino-2,4-dimethylphenyl)-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methanone.
| Compound Name | (5-amino-2,4-dimethylphenyl)-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methanone |
|---|---|
| PubChem CID | 102707076 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (5-amino-2,4-dimethylphenyl)-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2cc(Cl)cc3c2OCC3)cc1N |
| InChI | InChI=1S/C17H16ClNO2/c1-9-5-10(2)15(19)8-13(9)16(20)14-7-12(18)6-11-3-4-21-17(11)14/h5-8H,3-4,19H2,1-2H3 |
| InChIKey | QVBPDMQCNIHLPT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|