C15H9Cl2IO2 — CID 103219837
(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-(3-chloro-4-iodophenyl)methanone (PubChem CID 103219837) has the molecular formula C15H9Cl2IO2 and a molecular weight of 419.05 g/mol. Its IUPAC name is (5-chloro-2,3-dihydro-1-benzofuran-7-yl)-(3-chloro-4-iodophenyl)methanone.
| Compound Name | (5-chloro-2,3-dihydro-1-benzofuran-7-yl)-(3-chloro-4-iodophenyl)methanone |
|---|---|
| PubChem CID | 103219837 |
| Molecular Formula | C15H9Cl2IO2 |
| Molecular Weight | 419.05 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | (5-chloro-2,3-dihydro-1-benzofuran-7-yl)-(3-chloro-4-iodophenyl)methanone |
| SMILES | O=C(c1ccc(I)c(Cl)c1)c1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C15H9Cl2IO2/c16-10-5-9-3-4-20-15(9)11(7-10)14(19)8-1-2-13(18)12(17)6-8/h1-2,5-7H,3-4H2 |
| InChIKey | HVQHLRUYALEPJY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.05 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|