C16H13Cl2IO2 — CID 103217068
2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-1-(3-chloro-4-iodophenyl)ethanol (PubChem CID 103217068) has the molecular formula C16H13Cl2IO2 and a molecular weight of 435.09 g/mol. Its IUPAC name is 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-1-(3-chloro-4-iodophenyl)ethanol.
| Compound Name | 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-1-(3-chloro-4-iodophenyl)ethanol |
|---|---|
| PubChem CID | 103217068 |
| Molecular Formula | C16H13Cl2IO2 |
| Molecular Weight | 435.09 g/mol |
| Exact Mass | 433.93 |
| IUPAC Name | 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-1-(3-chloro-4-iodophenyl)ethanol |
| SMILES | OC(Cc1cc(Cl)cc2c1OCC2)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2IO2/c17-12-5-10-3-4-21-16(10)11(6-12)8-15(20)9-1-2-14(19)13(18)7-9/h1-2,5-7,15,20H,3-4,8H2 |
| InChIKey | IHIFEVXRUXRYJQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.09 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|