C10H11ClO — CID 130750027
6-(2-chloroethyl)-2,3-dihydro-1-benzofuran (PubChem CID 130750027) has the molecular formula C10H11ClO and a molecular weight of 182.65 g/mol. Its IUPAC name is 6-(2-chloroethyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 6-(2-chloroethyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 130750027 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 6-(2-chloroethyl)-2,3-dihydro-1-benzofuran |
| SMILES | ClCCc1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C10H11ClO/c11-5-3-8-1-2-9-4-6-12-10(9)7-8/h1-2,7H,3-6H2 |
| InChIKey | OIVSOGGXECDFKG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|