C19H24O — CID 44586777
(5R,6R)-4-methyl-5-pentyl-6-phenylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 44586777) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is (5R,6R)-4-methyl-5-pentyl-6-phenylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | (5R,6R)-4-methyl-5-pentyl-6-phenylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 44586777 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (5R,6R)-4-methyl-5-pentyl-6-phenylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CCCCC[C@H]1C(C)=CC=C(C=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H24O/c1-3-4-6-11-18-15(2)12-13-17(14-20)19(18)16-9-7-5-8-10-16/h5,7-10,12-14,18-19H,3-4,6,11H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | FZJBVGCYNYLPQW-RBUKOAKNSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|