C14H14O — CID 101450400
(6R)-4-methyl-6-phenylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 101450400) has the molecular formula C14H14O and a molecular weight of 198.26 g/mol. Its IUPAC name is (6R)-4-methyl-6-phenylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | (6R)-4-methyl-6-phenylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 101450400 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (6R)-4-methyl-6-phenylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC1=CC=C(C=O)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C14H14O/c1-11-7-8-13(10-15)14(9-11)12-5-3-2-4-6-12/h2-8,10,14H,9H2,1H3/t14-/m1/s1 |
| InChIKey | CWURJFZJIAPJTH-CQSZACIVSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|