C15H16O2 — CID 102406673
(1R,2R)-4-methyl-2-phenylcyclohex-3-ene-1,3-dicarbaldehyde (PubChem CID 102406673) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (1R,2R)-4-methyl-2-phenylcyclohex-3-ene-1,3-dicarbaldehyde.
| Compound Name | (1R,2R)-4-methyl-2-phenylcyclohex-3-ene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 102406673 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (1R,2R)-4-methyl-2-phenylcyclohex-3-ene-1,3-dicarbaldehyde |
| SMILES | CC1=C(C=O)[C@@H](c2ccccc2)[C@H](C=O)CC1 |
| InChI | InChI=1S/C15H16O2/c1-11-7-8-13(9-16)15(14(11)10-17)12-5-3-2-4-6-12/h2-6,9-10,13,15H,7-8H2,1H3/t13-,15-/m0/s1 |
| InChIKey | KCOFUOWDQJOOEG-ZFWWWQNUSA-N |
| XLogP | 2.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|