C26H28 — CID 164665856
(4R,5R,8aS,8bS)-3,6-dimethyl-4,5-diphenyl-1,2,4,5,7,8,8a,8b-octahydro-as-indacene (PubChem CID 164665856) has the molecular formula C26H28 and a molecular weight of 340.51 g/mol. Its IUPAC name is (4R,5R,8aS,8bS)-3,6-dimethyl-4,5-diphenyl-1,2,4,5,7,8,8a,8b-octahydro-as-indacene.
| Compound Name | (4R,5R,8aS,8bS)-3,6-dimethyl-4,5-diphenyl-1,2,4,5,7,8,8a,8b-octahydro-as-indacene |
|---|---|
| PubChem CID | 164665856 |
| Molecular Formula | C26H28 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (4R,5R,8aS,8bS)-3,6-dimethyl-4,5-diphenyl-1,2,4,5,7,8,8a,8b-octahydro-as-indacene |
| SMILES | CC1=C2[C@@H](CC1)[C@@H]1CCC(C)=C1[C@@H](c1ccccc1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C26H28/c1-17-13-15-21-22-16-14-18(2)24(22)26(20-11-7-4-8-12-20)25(23(17)21)19-9-5-3-6-10-19/h3-12,21-22,25-26H,13-16H2,1-2H3/t21-,22-,25+,26+/m0/s1 |
| InChIKey | RIQLQLNZCBYPJS-CNXCYTMISA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|