C21H31NO4 — CID 139935287
(4R,5S)-3-benzyl-5-decyl-2-oxo-1,3-oxazolidine-4-carboxylic acid (PubChem CID 139935287) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is (4R,5S)-3-benzyl-5-decyl-2-oxo-1,3-oxazolidine-4-carboxylic acid.
| Compound Name | (4R,5S)-3-benzyl-5-decyl-2-oxo-1,3-oxazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 139935287 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | (4R,5S)-3-benzyl-5-decyl-2-oxo-1,3-oxazolidine-4-carboxylic acid |
| SMILES | CCCCCCCCCC[C@@H]1OC(=O)N(Cc2ccccc2)[C@H]1C(=O)O |
| InChI | InChI=1S/C21H31NO4/c1-2-3-4-5-6-7-8-12-15-18-19(20(23)24)22(21(25)26-18)16-17-13-10-9-11-14-17/h9-11,13-14,18-19H,2-8,12,15-16H2,1H3,(H,23,24)/t18-,19+/m0/s1 |
| InChIKey | UHMSTFBKAYBUKG-RBUKOAKNSA-N |
| XLogP | 4.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|