C19H27F2NO — CID 10336322
(3S,4R)-1-benzyl-4-(difluoromethyl)-3-octylazetidin-2-one (PubChem CID 10336322) has the molecular formula C19H27F2NO and a molecular weight of 323.43 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-(difluoromethyl)-3-octylazetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-4-(difluoromethyl)-3-octylazetidin-2-one |
|---|---|
| PubChem CID | 10336322 |
| Molecular Formula | C19H27F2NO |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (3S,4R)-1-benzyl-4-(difluoromethyl)-3-octylazetidin-2-one |
| SMILES | CCCCCCCC[C@@H]1C(=O)N(Cc2ccccc2)[C@H]1C(F)F |
| InChI | InChI=1S/C19H27F2NO/c1-2-3-4-5-6-10-13-16-17(18(20)21)22(19(16)23)14-15-11-8-7-9-12-15/h7-9,11-12,16-18H,2-6,10,13-14H2,1H3/t16-,17+/m0/s1 |
| InChIKey | IFDVEPHRKAJTBG-DLBZAZTESA-N |
| XLogP | 5.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|