C18H27N — CID 146451701
1-benzyl-3-hexyl-3,6-dihydro-2H-pyridine (PubChem CID 146451701) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-benzyl-3-hexyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-3-hexyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 146451701 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 1-benzyl-3-hexyl-3,6-dihydro-2H-pyridine |
| SMILES | CCCCCCC1C=CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H27N/c1-2-3-4-6-10-18-13-9-14-19(16-18)15-17-11-7-5-8-12-17/h5,7-9,11-13,18H,2-4,6,10,14-16H2,1H3 |
| InChIKey | XWDTWGZTUXSOSB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|