C20H22BrN — CID 146535594
(3R)-1-benzyl-3-[2-(2-bromophenyl)ethyl]-3,6-dihydro-2H-pyridine (PubChem CID 146535594) has the molecular formula C20H22BrN and a molecular weight of 356.31 g/mol. Its IUPAC name is (3R)-1-benzyl-3-[2-(2-bromophenyl)ethyl]-3,6-dihydro-2H-pyridine.
| Compound Name | (3R)-1-benzyl-3-[2-(2-bromophenyl)ethyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 146535594 |
| Molecular Formula | C20H22BrN |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (3R)-1-benzyl-3-[2-(2-bromophenyl)ethyl]-3,6-dihydro-2H-pyridine |
| SMILES | Brc1ccccc1CC[C@@H]1C=CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H22BrN/c21-20-11-5-4-10-19(20)13-12-18-9-6-14-22(16-18)15-17-7-2-1-3-8-17/h1-11,18H,12-16H2/t18-/m0/s1 |
| InChIKey | UTPGYNTXIPRMMP-SFHVURJKSA-N |
| XLogP | 5.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|