C14H19N — CID 167582068
3-methyl-1-(2-phenylethyl)-3,6-dihydro-2H-pyridine (PubChem CID 167582068) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-methyl-1-(2-phenylethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 3-methyl-1-(2-phenylethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 167582068 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-methyl-1-(2-phenylethyl)-3,6-dihydro-2H-pyridine |
| SMILES | CC1C=CCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C14H19N/c1-13-6-5-10-15(12-13)11-9-14-7-3-2-4-8-14/h2-8,13H,9-12H2,1H3 |
| InChIKey | NXYORXWYXKFUCI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|