C13H17BrN2 — CID 84812065
3-[2-(2-bromophenyl)ethyl]-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 84812065) has the molecular formula C13H17BrN2 and a molecular weight of 281.20 g/mol. Its IUPAC name is 3-[2-(2-bromophenyl)ethyl]-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 3-[2-(2-bromophenyl)ethyl]-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 84812065 |
| Molecular Formula | C13H17BrN2 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 3-[2-(2-bromophenyl)ethyl]-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | Brc1ccccc1CCN1CC2CC(C1)N2 |
| InChI | InChI=1S/C13H17BrN2/c14-13-4-2-1-3-10(13)5-6-16-8-11-7-12(9-16)15-11/h1-4,11-12,15H,5-9H2 |
| InChIKey | MBVJRPIOXFJKRK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |