C20H23NO2 — CID 50906529
(3R,4R)-1-benzyl-4-phenylmethoxy-2,3,4,7-tetrahydroazepin-3-ol (PubChem CID 50906529) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-phenylmethoxy-2,3,4,7-tetrahydroazepin-3-ol.
| Compound Name | (3R,4R)-1-benzyl-4-phenylmethoxy-2,3,4,7-tetrahydroazepin-3-ol |
|---|---|
| PubChem CID | 50906529 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (3R,4R)-1-benzyl-4-phenylmethoxy-2,3,4,7-tetrahydroazepin-3-ol |
| SMILES | O[C@@H]1CN(Cc2ccccc2)CC=C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c22-19-15-21(14-17-8-3-1-4-9-17)13-7-12-20(19)23-16-18-10-5-2-6-11-18/h1-12,19-20,22H,13-16H2/t19-,20-/m1/s1 |
| InChIKey | FSFPIDHVRCZSIX-WOJBJXKFSA-N |
| XLogP | 3.00 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|