C20H22ClNO — CID 45101703
(2S,3S)-1-benzyl-2-(chloromethyl)-3-phenylmethoxy-3,6-dihydro-2H-pyridine (PubChem CID 45101703) has the molecular formula C20H22ClNO and a molecular weight of 327.86 g/mol. Its IUPAC name is (2S,3S)-1-benzyl-2-(chloromethyl)-3-phenylmethoxy-3,6-dihydro-2H-pyridine.
| Compound Name | (2S,3S)-1-benzyl-2-(chloromethyl)-3-phenylmethoxy-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 45101703 |
| Molecular Formula | C20H22ClNO |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (2S,3S)-1-benzyl-2-(chloromethyl)-3-phenylmethoxy-3,6-dihydro-2H-pyridine |
| SMILES | ClC[C@@H]1[C@@H](OCc2ccccc2)C=CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H22ClNO/c21-14-19-20(23-16-18-10-5-2-6-11-18)12-7-13-22(19)15-17-8-3-1-4-9-17/h1-12,19-20H,13-16H2/t19-,20+/m1/s1 |
| InChIKey | CJTZKSGSFAYARK-UXHICEINSA-N |
| XLogP | 4.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|