C40H37NO4 — CID 53355766
benzyl (2S,3S)-3-phenylmethoxy-2-(trityloxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 53355766) has the molecular formula C40H37NO4 and a molecular weight of 595.74 g/mol. Its IUPAC name is benzyl (2S,3S)-3-phenylmethoxy-2-(trityloxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl (2S,3S)-3-phenylmethoxy-2-(trityloxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 53355766 |
| Molecular Formula | C40H37NO4 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | benzyl (2S,3S)-3-phenylmethoxy-2-(trityloxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC=C[C@H](OCc2ccccc2)[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H37NO4/c42-39(44-30-33-19-8-2-9-20-33)41-28-16-27-38(43-29-32-17-6-1-7-18-32)37(41)31-45-40(34-21-10-3-11-22-34,35-23-12-4-13-24-35)36-25-14-5-15-26-36/h1-27,37-38H,28-31H2/t37-,38-/m0/s1 |
| InChIKey | VKTHOAIMKKVXCA-UWXQCODUSA-N |
| XLogP | 8.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|