C15H18N2O2S2 — CID 101399126
(1S,4S)-5-benzyl-7-butyl-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione (PubChem CID 101399126) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is (1S,4S)-5-benzyl-7-butyl-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione.
| Compound Name | (1S,4S)-5-benzyl-7-butyl-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione |
|---|---|
| PubChem CID | 101399126 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (1S,4S)-5-benzyl-7-butyl-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione |
| SMILES | CCCCN1C(=O)[C@@H]2SS[C@H]1C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-2-3-9-16-12(18)15-17(13(19)14(16)20-21-15)10-11-7-5-4-6-8-11/h4-8,14-15H,2-3,9-10H2,1H3/t14-,15-/m0/s1 |
| InChIKey | YSCFSMSDDWVONT-GJZGRUSLSA-N |
| XLogP | 2.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|