C11H13ClS — CID 131033869
[(1S,2S,3S)-2-chloro-1-methyl-3-methylsulfanylcyclopropyl]benzene (PubChem CID 131033869) has the molecular formula C11H13ClS and a molecular weight of 212.75 g/mol. Its IUPAC name is [(1S,2S,3S)-2-chloro-1-methyl-3-methylsulfanylcyclopropyl]benzene.
| Compound Name | [(1S,2S,3S)-2-chloro-1-methyl-3-methylsulfanylcyclopropyl]benzene |
|---|---|
| PubChem CID | 131033869 |
| Molecular Formula | C11H13ClS |
| Molecular Weight | 212.75 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | [(1S,2S,3S)-2-chloro-1-methyl-3-methylsulfanylcyclopropyl]benzene |
| SMILES | CS[C@@H]1[C@@H](Cl)[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C11H13ClS/c1-11(9(12)10(11)13-2)8-6-4-3-5-7-8/h3-7,9-10H,1-2H3/t9-,10-,11-/m1/s1 |
| InChIKey | VKBCYTGNKLQEDO-GMTAPVOTSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.75 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|