C21H11Cl2F3N2O2S — CID 135470217
4-(4-chlorophenyl)imino-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-2-one (PubChem CID 135470217) has the molecular formula C21H11Cl2F3N2O2S and a molecular weight of 483.30 g/mol. Its IUPAC name is 4-(4-chlorophenyl)imino-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-2-one.
| Compound Name | 4-(4-chlorophenyl)imino-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135470217 |
| Molecular Formula | C21H11Cl2F3N2O2S |
| Molecular Weight | 483.30 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | 4-(4-chlorophenyl)imino-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-2-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2)C(=Cc2ccc(-c3cc(C(F)(F)F)ccc3Cl)o2)S1 |
| InChI | InChI=1S/C21H11Cl2F3N2O2S/c22-12-2-4-13(5-3-12)27-19-18(31-20(29)28-19)10-14-6-8-17(30-14)15-9-11(21(24,25)26)1-7-16(15)23/h1-10H,(H,27,28,29) |
| InChIKey | JHVOCRXBHRMMTB-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.30 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|