C18H13F2NO2S2 — CID 162579593
(5E)-5-[[5-[3-[(E)-1,1-difluorobut-2-enyl]phenyl]furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 162579593) has the molecular formula C18H13F2NO2S2 and a molecular weight of 377.44 g/mol. Its IUPAC name is (5E)-5-[[5-[3-[(E)-1,1-difluorobut-2-enyl]phenyl]furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | (5E)-5-[[5-[3-[(E)-1,1-difluorobut-2-enyl]phenyl]furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 162579593 |
| Molecular Formula | C18H13F2NO2S2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (5E)-5-[[5-[3-[(E)-1,1-difluorobut-2-enyl]phenyl]furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | C/C=C/C(F)(F)c1cccc(-c2ccc(/C=C3/SC(=O)NC3=S)o2)c1 |
| InChI | InChI=1S/C18H13F2NO2S2/c1-2-8-18(19,20)12-5-3-4-11(9-12)14-7-6-13(23-14)10-15-16(24)21-17(22)25-15/h2-10H,1H3,(H,21,22,24)/b8-2+,15-10+ |
| InChIKey | DBXAYKHFEWMNJO-MUOTVJORSA-N |
| XLogP | 5.74 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|