C15H8N2O2S3 — CID 2019480
(5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 2019480) has the molecular formula C15H8N2O2S3 and a molecular weight of 344.44 g/mol. Its IUPAC name is (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 2019480 |
| Molecular Formula | C15H8N2O2S3 |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=S)/C(=C/c2ccc(-c3nc4ccccc4s3)o2)S1 |
| InChI | InChI=1S/C15H8N2O2S3/c18-15-17-13(20)12(22-15)7-8-5-6-10(19-8)14-16-9-3-1-2-4-11(9)21-14/h1-7H,(H,17,18,20)/b12-7- |
| InChIKey | MKQQGLKYMSNYAN-GHXNOFRVSA-N |
| XLogP | 4.68 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|