C15H9N3O2S2 — CID 3887887
5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 3887887) has the molecular formula C15H9N3O2S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 3887887 |
| Molecular Formula | C15H9N3O2S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)NC1=Cc1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C15H9N3O2S2/c19-13-10(17-15(21)18-13)7-8-5-6-11(20-8)14-16-9-3-1-2-4-12(9)22-14/h1-7H,(H2,17,18,19,21) |
| InChIKey | AJHQCXQRAYLZML-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|