C21H14N2O2S — CID 5030169
3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-7-methyl-1H-indol-2-one (PubChem CID 5030169) has the molecular formula C21H14N2O2S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-7-methyl-1H-indol-2-one.
| Compound Name | 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-7-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 5030169 |
| Molecular Formula | C21H14N2O2S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-7-methyl-1H-indol-2-one |
| SMILES | Cc1cccc2c1NC(=O)C2=Cc1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C21H14N2O2S/c1-12-5-4-6-14-15(20(24)23-19(12)14)11-13-9-10-17(25-13)21-22-16-7-2-3-8-18(16)26-21/h2-11H,1H3,(H,23,24) |
| InChIKey | YCPHLAQSWKAAAU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|