C22H14N2O3S2 — CID 3731912
5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-3-(3-methylphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 3731912) has the molecular formula C22H14N2O3S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-3-(3-methylphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-3-(3-methylphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3731912 |
| Molecular Formula | C22H14N2O3S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-3-(3-methylphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cccc(N2C(=O)SC(=Cc3ccc(-c4nc5ccccc5s4)o3)C2=O)c1 |
| InChI | InChI=1S/C22H14N2O3S2/c1-13-5-4-6-14(11-13)24-21(25)19(29-22(24)26)12-15-9-10-17(27-15)20-23-16-7-2-3-8-18(16)28-20/h2-12H,1H3 |
| InChIKey | JUZQBXWZIHVNIU-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|