C18H14N4O2S — CID 9024918
6-amino-1-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-4-methylpyridin-2-one (PubChem CID 9024918) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is 6-amino-1-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-4-methylpyridin-2-one.
| Compound Name | 6-amino-1-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 9024918 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 6-amino-1-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-4-methylpyridin-2-one |
| SMILES | Cc1cc(N)n(/N=C\c2ccc(-c3nc4ccccc4s3)o2)c(=O)c1 |
| InChI | InChI=1S/C18H14N4O2S/c1-11-8-16(19)22(17(23)9-11)20-10-12-6-7-14(24-12)18-21-13-4-2-3-5-15(13)25-18/h2-10H,19H2,1H3/b20-10- |
| InChIKey | NUGJAOFATJOYCH-JMIUGGIZSA-N |
| XLogP | 3.49 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|