C19H10N2O6S3-2 — CID 2037462
(2R)-2-[(5E)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioate (PubChem CID 2037462) has the molecular formula C19H10N2O6S3-2 and a molecular weight of 458.50 g/mol. Its IUPAC name is (2R)-2-[(5E)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioate.
| Compound Name | (2R)-2-[(5E)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioate |
|---|---|
| PubChem CID | 2037462 |
| Molecular Formula | C19H10N2O6S3-2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | (2R)-2-[(5E)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioate |
| SMILES | O=C([O-])C[C@H](C(=O)[O-])N1C(=O)/C(=C\c2ccc(-c3nc4ccccc4s3)o2)SC1=S |
| InChI | InChI=1S/C19H12N2O6S3/c22-15(23)8-11(18(25)26)21-17(24)14(30-19(21)28)7-9-5-6-12(27-9)16-20-10-3-1-2-4-13(10)29-16/h1-7,11H,8H2,(H,22,23)(H,25,26)/p-2/b14-7+/t11-/m1/s1 |
| InChIKey | ZUTDAWTWLZTAEP-LLUUXILJSA-L |
| XLogP | 1.02 |
| TPSA | 126.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|