C19H12Cl2N2O2S — CID 94851103
(E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 94851103) has the molecular formula C19H12Cl2N2O2S and a molecular weight of 403.29 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 94851103 |
| Molecular Formula | C19H12Cl2N2O2S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2cc(Cl)ccc2Cl)o1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C19H12Cl2N2O2S/c20-13-3-5-17(21)16(9-13)18-6-4-14(25-18)8-12(10-22)19(24)23-11-15-2-1-7-26-15/h1-9H,11H2,(H,23,24)/b12-8+ |
| InChIKey | XJMPVVPZMIFJQD-XYOKQWHBSA-N |
| XLogP | 5.54 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|