C22H16N2O5 — CID 1269175
2-[5-[2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid (PubChem CID 1269175) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-[5-[2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 1269175 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[5-[2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
| SMILES | COc1ccc(NC(=O)C(C#N)=Cc2ccc(-c3ccccc3C(=O)O)o2)cc1 |
| InChI | InChI=1S/C22H16N2O5/c1-28-16-8-6-15(7-9-16)24-21(25)14(13-23)12-17-10-11-20(29-17)18-4-2-3-5-19(18)22(26)27/h2-12H,1H3,(H,24,25)(H,26,27) |
| InChIKey | LMLAEGXSFCPUAF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 112.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|