C20H24FN3OS — CID 145486423
2-ethylsulfanyl-1H-benzimidazole;1-fluoro-4-prop-1-en-2-ylbenzene;N-methylformamide (PubChem CID 145486423) has the molecular formula C20H24FN3OS and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-ethylsulfanyl-1H-benzimidazole;1-fluoro-4-prop-1-en-2-ylbenzene;N-methylformamide.
| Compound Name | 2-ethylsulfanyl-1H-benzimidazole;1-fluoro-4-prop-1-en-2-ylbenzene;N-methylformamide |
|---|---|
| PubChem CID | 145486423 |
| Molecular Formula | C20H24FN3OS |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-ethylsulfanyl-1H-benzimidazole;1-fluoro-4-prop-1-en-2-ylbenzene;N-methylformamide |
| SMILES | C=C(C)c1ccc(F)cc1.CCSc1nc2ccccc2[nH]1.CNC=O |
| InChI | InChI=1S/C9H9F.C9H10N2S.C2H5NO/c1-7(2)8-3-5-9(10)6-4-8;1-2-12-9-10-7-5-3-4-6-8(7)11-9;1-3-2-4/h3-6H,1H2,2H3;3-6H,2H2,1H3,(H,10,11);2H,1H3,(H,3,4) |
| InChIKey | CHYFHSFYDCBISK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|