C15H23N3S — CID 62583736
N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-4-methylpentan-1-amine (PubChem CID 62583736) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-4-methylpentan-1-amine.
| Compound Name | N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 62583736 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-4-methylpentan-1-amine |
| SMILES | CC(C)CCCNCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H23N3S/c1-12(2)6-5-9-16-10-11-19-15-17-13-7-3-4-8-14(13)18-15/h3-4,7-8,12,16H,5-6,9-11H2,1-2H3,(H,17,18) |
| InChIKey | RYKGLPBIUCIFCL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|