C24H19N5O5S — CID 3588965
N'-[2-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-4-nitrobenzohydrazide (PubChem CID 3588965) has the molecular formula C24H19N5O5S and a molecular weight of 489.51 g/mol. Its IUPAC name is N'-[2-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[2-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 3588965 |
| Molecular Formula | C24H19N5O5S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N'-[2-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-4-nitrobenzohydrazide |
| SMILES | Cc1cccc(-n2c(SCC(=O)NNC(=O)c3ccc([N+](=O)[O-])cc3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C24H19N5O5S/c1-15-5-4-6-18(13-15)28-23(32)19-7-2-3-8-20(19)25-24(28)35-14-21(30)26-27-22(31)16-9-11-17(12-10-16)29(33)34/h2-13H,14H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | OWZLYGJIHOLNQW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|