C24H18N4O5S — CID 2094457
N-[2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-3-nitrobenzamide (PubChem CID 2094457) has the molecular formula C24H18N4O5S and a molecular weight of 474.50 g/mol. Its IUPAC name is N-[2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-3-nitrobenzamide.
| Compound Name | N-[2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 2094457 |
| Molecular Formula | C24H18N4O5S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)NC(=O)c3cccc([N+](=O)[O-])c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H18N4O5S/c1-15-9-11-17(12-10-15)27-23(31)19-7-2-3-8-20(19)25-24(27)34-14-21(29)26-22(30)16-5-4-6-18(13-16)28(32)33/h2-13H,14H2,1H3,(H,26,29,30) |
| InChIKey | CAYICFHLNTWFIH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|