C14H13N3O3S2 — CID 36668177
3-(2,5-dioxopyrrolidin-1-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)propanamide (PubChem CID 36668177) has the molecular formula C14H13N3O3S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 36668177 |
| Molecular Formula | C14H13N3O3S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)CCC1=O)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C14H13N3O3S2/c18-11(5-6-17-12(19)3-4-13(17)20)16-14-15-9(8-22-14)10-2-1-7-21-10/h1-2,7-8H,3-6H2,(H,15,16,18) |
| InChIKey | HCGCOQNWNABPAH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|