C19H19FN4O4S — CID 55972235
N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 55972235) has the molecular formula C19H19FN4O4S and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 55972235 |
| Molecular Formula | C19H19FN4O4S |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | COc1ccc(CSCC(=O)NCCNc2cccc(F)c2C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19FN4O4S/c1-28-18-6-5-13(9-17(18)24(26)27)11-29-12-19(25)23-8-7-22-16-4-2-3-15(20)14(16)10-21/h2-6,9,22H,7-8,11-12H2,1H3,(H,23,25) |
| InChIKey | CGAGUVOHDIOCNT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|