C19H22N2O5S — CID 55461261
(E)-N-(2-nitro-4,5-dipropoxyphenyl)-3-thiophen-3-ylprop-2-enamide (PubChem CID 55461261) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is (E)-N-(2-nitro-4,5-dipropoxyphenyl)-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-N-(2-nitro-4,5-dipropoxyphenyl)-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 55461261 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (E)-N-(2-nitro-4,5-dipropoxyphenyl)-3-thiophen-3-ylprop-2-enamide |
| SMILES | CCCOc1cc(NC(=O)/C=C/c2ccsc2)c([N+](=O)[O-])cc1OCCC |
| InChI | InChI=1S/C19H22N2O5S/c1-3-8-25-17-11-15(16(21(23)24)12-18(17)26-9-4-2)20-19(22)6-5-14-7-10-27-13-14/h5-7,10-13H,3-4,8-9H2,1-2H3,(H,20,22)/b6-5+ |
| InChIKey | FASMJNKNMZRBSO-AATRIKPKSA-N |
| XLogP | 4.89 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|