C20H18FN3O5S — CID 78829003
N-(4,5-diethoxy-2-nitrophenyl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 78829003) has the molecular formula C20H18FN3O5S and a molecular weight of 431.45 g/mol. Its IUPAC name is N-(4,5-diethoxy-2-nitrophenyl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4,5-diethoxy-2-nitrophenyl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 78829003 |
| Molecular Formula | C20H18FN3O5S |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N-(4,5-diethoxy-2-nitrophenyl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2csc(-c3ccc(F)cc3)n2)c([N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C20H18FN3O5S/c1-3-28-17-9-14(16(24(26)27)10-18(17)29-4-2)22-19(25)15-11-30-20(23-15)12-5-7-13(21)8-6-12/h5-11H,3-4H2,1-2H3,(H,22,25) |
| InChIKey | OGXYDNKOIBASNJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|