C14H9F5N2O — CID 66880339
1-(2,6-difluoro-4-methoxyphenyl)-N-[6-(trifluoromethyl)-3-pyridinyl]methanimine (PubChem CID 66880339) has the molecular formula C14H9F5N2O and a molecular weight of 316.23 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-methoxyphenyl)-N-[6-(trifluoromethyl)-3-pyridinyl]methanimine.
| Compound Name | 1-(2,6-difluoro-4-methoxyphenyl)-N-[6-(trifluoromethyl)-3-pyridinyl]methanimine |
|---|---|
| PubChem CID | 66880339 |
| Molecular Formula | C14H9F5N2O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-(2,6-difluoro-4-methoxyphenyl)-N-[6-(trifluoromethyl)-3-pyridinyl]methanimine |
| SMILES | COc1cc(F)c(/C=N/c2ccc(C(F)(F)F)nc2)c(F)c1 |
| InChI | InChI=1S/C14H9F5N2O/c1-22-9-4-11(15)10(12(16)5-9)7-20-8-2-3-13(21-6-8)14(17,18)19/h2-7H,1H3/b20-7+ |
| InChIKey | RRXTUTNSDDFHHC-IFRROFPPSA-N |
| XLogP | 4.14 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|