C15H9F5N2O — CID 19368504
(E)-N-[(E)-(2,6-difluoro-4-methoxyphenyl)methylideneamino]-1-(3,4,5-trifluorophenyl)methanimine (PubChem CID 19368504) has the molecular formula C15H9F5N2O and a molecular weight of 328.24 g/mol. Its IUPAC name is (E)-N-[(E)-(2,6-difluoro-4-methoxyphenyl)methylideneamino]-1-(3,4,5-trifluorophenyl)methanimine.
| Compound Name | (E)-N-[(E)-(2,6-difluoro-4-methoxyphenyl)methylideneamino]-1-(3,4,5-trifluorophenyl)methanimine |
|---|---|
| PubChem CID | 19368504 |
| Molecular Formula | C15H9F5N2O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | (E)-N-[(E)-(2,6-difluoro-4-methoxyphenyl)methylideneamino]-1-(3,4,5-trifluorophenyl)methanimine |
| SMILES | COc1cc(F)c(/C=N/N=C/c2cc(F)c(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C15H9F5N2O/c1-23-9-4-11(16)10(12(17)5-9)7-22-21-6-8-2-13(18)15(20)14(19)3-8/h2-7H,1H3/b21-6+,22-7+ |
| InChIKey | UFEHNQISNRBZCQ-JSCKAOMZSA-N |
| XLogP | 3.84 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|