C17H13F5N2O2 — CID 19368822
(E)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1-(4-methoxyphenyl)methanimine (PubChem CID 19368822) has the molecular formula C17H13F5N2O2 and a molecular weight of 372.29 g/mol. Its IUPAC name is (E)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1-(4-methoxyphenyl)methanimine.
| Compound Name | (E)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 19368822 |
| Molecular Formula | C17H13F5N2O2 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (E)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/N=C/c2cc(F)c(OCC(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H13F5N2O2/c1-25-13-4-2-11(3-5-13)8-23-24-9-12-6-14(18)16(15(19)7-12)26-10-17(20,21)22/h2-9H,10H2,1H3/b23-8+,24-9+ |
| InChIKey | ISOFDQLAMGQBQW-NBBXXHIDSA-N |
| XLogP | 4.37 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|