C20H19F5N2O — CID 19368700
(E)-1-(4-butylphenyl)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]methanimine (PubChem CID 19368700) has the molecular formula C20H19F5N2O and a molecular weight of 398.38 g/mol. Its IUPAC name is (E)-1-(4-butylphenyl)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]methanimine.
| Compound Name | (E)-1-(4-butylphenyl)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]methanimine |
|---|---|
| PubChem CID | 19368700 |
| Molecular Formula | C20H19F5N2O |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (E)-1-(4-butylphenyl)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]methanimine |
| SMILES | CCCCc1ccc(/C=N/N=C/c2cc(F)c(OCC(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H19F5N2O/c1-2-3-4-14-5-7-15(8-6-14)11-26-27-12-16-9-17(21)19(18(22)10-16)28-13-20(23,24)25/h5-12H,2-4,13H2,1H3/b26-11+,27-12+ |
| InChIKey | PPOOOTIUZZYXOB-LYXAAFRTSA-N |
| XLogP | 5.70 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|