C18H15F5N2O — CID 19368359
(E)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1-(4-ethylphenyl)methanimine (PubChem CID 19368359) has the molecular formula C18H15F5N2O and a molecular weight of 370.32 g/mol. Its IUPAC name is (E)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1-(4-ethylphenyl)methanimine.
| Compound Name | (E)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1-(4-ethylphenyl)methanimine |
|---|---|
| PubChem CID | 19368359 |
| Molecular Formula | C18H15F5N2O |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (E)-N-[(E)-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1-(4-ethylphenyl)methanimine |
| SMILES | CCc1ccc(/C=N/N=C/c2cc(F)c(OCC(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H15F5N2O/c1-2-12-3-5-13(6-4-12)9-24-25-10-14-7-15(19)17(16(20)8-14)26-11-18(21,22)23/h3-10H,2,11H2,1H3/b24-9+,25-10+ |
| InChIKey | RGNDDLXTDAWNNO-HGELYGIESA-N |
| XLogP | 4.92 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|