C18H18F2N2 — CID 19368686
(E)-N-[(E)-(4-ethyl-3,5-difluorophenyl)methylideneamino]-1-(4-ethylphenyl)methanimine (PubChem CID 19368686) has the molecular formula C18H18F2N2 and a molecular weight of 300.35 g/mol. Its IUPAC name is (E)-N-[(E)-(4-ethyl-3,5-difluorophenyl)methylideneamino]-1-(4-ethylphenyl)methanimine.
| Compound Name | (E)-N-[(E)-(4-ethyl-3,5-difluorophenyl)methylideneamino]-1-(4-ethylphenyl)methanimine |
|---|---|
| PubChem CID | 19368686 |
| Molecular Formula | C18H18F2N2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (E)-N-[(E)-(4-ethyl-3,5-difluorophenyl)methylideneamino]-1-(4-ethylphenyl)methanimine |
| SMILES | CCc1ccc(/C=N/N=C/c2cc(F)c(CC)c(F)c2)cc1 |
| InChI | InChI=1S/C18H18F2N2/c1-3-13-5-7-14(8-6-13)11-21-22-12-15-9-17(19)16(4-2)18(20)10-15/h5-12H,3-4H2,1-2H3/b21-11+,22-12+ |
| InChIKey | AOSVCFWUCAJRLM-XHQRYOPUSA-N |
| XLogP | 4.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|