C17H17FN2 — CID 19368641
(E)-N-[(E)-(4-ethyl-2-fluorophenyl)methylideneamino]-1-(4-methylphenyl)methanimine (PubChem CID 19368641) has the molecular formula C17H17FN2 and a molecular weight of 268.33 g/mol. Its IUPAC name is (E)-N-[(E)-(4-ethyl-2-fluorophenyl)methylideneamino]-1-(4-methylphenyl)methanimine.
| Compound Name | (E)-N-[(E)-(4-ethyl-2-fluorophenyl)methylideneamino]-1-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 19368641 |
| Molecular Formula | C17H17FN2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (E)-N-[(E)-(4-ethyl-2-fluorophenyl)methylideneamino]-1-(4-methylphenyl)methanimine |
| SMILES | CCc1ccc(/C=N/N=C/c2ccc(C)cc2)c(F)c1 |
| InChI | InChI=1S/C17H17FN2/c1-3-14-8-9-16(17(18)10-14)12-20-19-11-15-6-4-13(2)5-7-15/h4-12H,3H2,1-2H3/b19-11+,20-12+ |
| InChIKey | JQDJUTQDVHPWFQ-AYKLPDECSA-N |
| XLogP | 4.15 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|